C27H38ClN3O4Si — CID 174057675
[(4S)-1-[4-[tert-butyl(dimethyl)silyl]oxy-3-methylcyclohexyl]-4-(2-chloro-3-ethynylphenyl)-4-methyl-6-oxo-5H-pyrimidin-2-yl]carbamic acid (PubChem CID 174057675) has the molecular formula C27H38ClN3O4Si and a molecular weight of 532.16 g/mol. Its IUPAC name is [(4S)-1-[4-[tert-butyl(dimethyl)silyl]oxy-3-methylcyclohexyl]-4-(2-chloro-3-ethynylphenyl)-4-methyl-6-oxo-5H-pyrimidin-2-yl]carbamic acid.
| Compound Name | [(4S)-1-[4-[tert-butyl(dimethyl)silyl]oxy-3-methylcyclohexyl]-4-(2-chloro-3-ethynylphenyl)-4-methyl-6-oxo-5H-pyrimidin-2-yl]carbamic acid |
|---|---|
| PubChem CID | 174057675 |
| Molecular Formula | C27H38ClN3O4Si |
| Molecular Weight | 532.16 g/mol |
| Exact Mass | 531.23 |
| IUPAC Name | [(4S)-1-[4-[tert-butyl(dimethyl)silyl]oxy-3-methylcyclohexyl]-4-(2-chloro-3-ethynylphenyl)-4-methyl-6-oxo-5H-pyrimidin-2-yl]carbamic acid |
| SMILES | C#Cc1cccc([C@]2(C)CC(=O)N(C3CCC(O[Si](C)(C)C(C)(C)C)C(C)C3)C(NC(=O)O)=N2)c1Cl |
| InChI | InChI=1S/C27H38ClN3O4Si/c1-9-18-11-10-12-20(23(18)28)27(6)16-22(32)31(24(30-27)29-25(33)34)19-13-14-21(17(2)15-19)35-36(7,8)26(3,4)5/h1,10-12,17,19,21H,13-16H2,2-8H3,(H,29,30)(H,33,34)/t17?,19?,21?,27-/m0/s1 |
| InChIKey | TZDMUCZNAGQHQW-GRXQOGPRSA-N |
| XLogP | 5.97 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.16 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|