About prop-2-enoxymethyl 3-cyclopentyl-2-methylbut-2-enoate
prop-2-enoxymethyl 3-cyclopentyl-2-methylbut-2-enoate (PubChem CID 174057672) has the molecular formula C14H22O3
and a molecular weight of 238.33 g/mol. Its IUPAC name is prop-2-enoxymethyl 3-cyclopentyl-2-methylbut-2-enoate.
Molecular Properties
| Compound Name | prop-2-enoxymethyl 3-cyclopentyl-2-methylbut-2-enoate |
| PubChem CID | 174057672 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | prop-2-enoxymethyl 3-cyclopentyl-2-methylbut-2-enoate |
| SMILES | C=CCOCOC(=O)C(C)=C(C)C1CCCC1 |
| InChI | InChI=1S/C14H22O3/c1-4-9-16-10-17-14(15)12(3)11(2)13-7-5-6-8-13/h4,13H,1,5-10H2,2-3H3 |
| InChIKey | POQUCLFKGDWAGM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enoxymethyl 3-cyclopentyl-2-methylbut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enoxymethyl 3-cyclopentyl-2-methylbut-2-enoate?
The IUPAC name of prop-2-enoxymethyl 3-cyclopentyl-2-methylbut-2-enoate (CID 174057672) is prop-2-enoxymethyl 3-cyclopentyl-2-methylbut-2-enoate.
What is the SMILES notation for prop-2-enoxymethyl 3-cyclopentyl-2-methylbut-2-enoate?
The canonical SMILES for prop-2-enoxymethyl 3-cyclopentyl-2-methylbut-2-enoate is C=CCOCOC(=O)C(C)=C(C)C1CCCC1.
What is the InChIKey of prop-2-enoxymethyl 3-cyclopentyl-2-methylbut-2-enoate?
The InChIKey is POQUCLFKGDWAGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O3/c1-4-9-16-10-17-14(15)12(3)11(2)13-7-5-6-8-13/h4,13H,1,5-10H2,2-3H3.
What are the key properties of prop-2-enoxymethyl 3-cyclopentyl-2-methylbut-2-enoate?
prop-2-enoxymethyl 3-cyclopentyl-2-methylbut-2-enoate has a molecular weight of 238.33 g/mol, XLogP of 3.22, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enoxymethyl 3-cyclopentyl-2-methylbut-2-enoate is sourced from PubChem (CID 174057672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).