C11H18O6 — CID 118254217
2-hydroxypropanoic acid;prop-2-enoxymethyl 2-methylprop-2-enoate (PubChem CID 118254217) has the molecular formula C11H18O6 and a molecular weight of 246.26 g/mol. Its IUPAC name is 2-hydroxypropanoic acid;prop-2-enoxymethyl 2-methylprop-2-enoate.
| Compound Name | 2-hydroxypropanoic acid;prop-2-enoxymethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118254217 |
| Molecular Formula | C11H18O6 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 2-hydroxypropanoic acid;prop-2-enoxymethyl 2-methylprop-2-enoate |
| SMILES | C=CCOCOC(=O)C(=C)C.CC(O)C(=O)O |
| InChI | InChI=1S/C8H12O3.C3H6O3/c1-4-5-10-6-11-8(9)7(2)3;1-2(4)3(5)6/h4H,1-2,5-6H2,3H3;2,4H,1H3,(H,5,6) |
| InChIKey | YGGUQBMXNAPBKU-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|