C19H22N4OSi — CID 174059960
[8-(1-methylpyrazol-4-yl)-2-trimethylsilyl-3H-pyrrolo[2,3-c]isoquinolin-1-yl]methanol (PubChem CID 174059960) has the molecular formula C19H22N4OSi and a molecular weight of 350.50 g/mol. Its IUPAC name is [8-(1-methylpyrazol-4-yl)-2-trimethylsilyl-3H-pyrrolo[2,3-c]isoquinolin-1-yl]methanol.
| Compound Name | [8-(1-methylpyrazol-4-yl)-2-trimethylsilyl-3H-pyrrolo[2,3-c]isoquinolin-1-yl]methanol |
|---|---|
| PubChem CID | 174059960 |
| Molecular Formula | C19H22N4OSi |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | [8-(1-methylpyrazol-4-yl)-2-trimethylsilyl-3H-pyrrolo[2,3-c]isoquinolin-1-yl]methanol |
| SMILES | Cn1cc(-c2ccc3cnc4[nH]c([Si](C)(C)C)c(CO)c4c3c2)cn1 |
| InChI | InChI=1S/C19H22N4OSi/c1-23-10-14(9-21-23)12-5-6-13-8-20-18-17(15(13)7-12)16(11-24)19(22-18)25(2,3)4/h5-10,24H,11H2,1-4H3,(H,20,22) |
| InChIKey | NXNWBRUJFIYOIF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|