C36H56O8 — CID 174062066
(3R,6S)-6-[(6aR,6bS,8aS,14bS)-8a-carboxy-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 174062066) has the molecular formula C36H56O8 and a molecular weight of 616.84 g/mol. Its IUPAC name is (3R,6S)-6-[(6aR,6bS,8aS,14bS)-8a-carboxy-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (3R,6S)-6-[(6aR,6bS,8aS,14bS)-8a-carboxy-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 174062066 |
| Molecular Formula | C36H56O8 |
| Molecular Weight | 616.84 g/mol |
| Exact Mass | 616.40 |
| IUPAC Name | (3R,6S)-6-[(6aR,6bS,8aS,14bS)-8a-carboxy-4,4,6a,6b,11,11,14b-heptamethyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | CC1(C)CC[C@]2(C(=O)O)CC[C@]3(C)C(=CCC4[C@@]5(C)CCC([C@@H]6OC(C(=O)O)[C@H](O)C(O)C6O)C(C)(C)C5CC[C@]43C)C2C1 |
| InChI | InChI=1S/C36H56O8/c1-31(2)14-16-36(30(42)43)17-15-34(6)19(21(36)18-31)8-9-23-33(5)12-10-20(32(3,4)22(33)11-13-35(23,34)7)27-25(38)24(37)26(39)28(44-27)29(40)41/h8,20-28,37-39H,9-18H2,1-7H3,(H,40,41)(H,42,43)/t20?,21?,22?,23?,24?,25?,26-,27+,28?,33+,34-,35-,36+/m1/s1 |
| InChIKey | BKGFNFUGHCLRHR-MVHUREAZSA-N |
| XLogP | 5.42 |
| TPSA | 144.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.84 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|