C36H53NO7 — CID 174061971
(1R,2S,5S,15R,18R,19R,21S)-19-[(2R,5S)-6-cyano-3,4,5-trihydroxyoxan-2-yl]-1,2,8,8,15,21-hexamethyl-20-oxahexacyclo[12.10.0.02,11.05,10.015,22.018,21]tetracos-11-ene-5-carboxylic acid (PubChem CID 174061971) has the molecular formula C36H53NO7 and a molecular weight of 611.82 g/mol. Its IUPAC name is (1R,2S,5S,15R,18R,19R,21S)-19-[(2R,5S)-6-cyano-3,4,5-trihydroxyoxan-2-yl]-1,2,8,8,15,21-hexamethyl-20-oxahexacyclo[12.10.0.02,11.05,10.015,22.018,21]tetracos-11-ene-5-carboxylic acid.
| Compound Name | (1R,2S,5S,15R,18R,19R,21S)-19-[(2R,5S)-6-cyano-3,4,5-trihydroxyoxan-2-yl]-1,2,8,8,15,21-hexamethyl-20-oxahexacyclo[12.10.0.02,11.05,10.015,22.018,21]tetracos-11-ene-5-carboxylic acid |
|---|---|
| PubChem CID | 174061971 |
| Molecular Formula | C36H53NO7 |
| Molecular Weight | 611.82 g/mol |
| Exact Mass | 611.38 |
| IUPAC Name | (1R,2S,5S,15R,18R,19R,21S)-19-[(2R,5S)-6-cyano-3,4,5-trihydroxyoxan-2-yl]-1,2,8,8,15,21-hexamethyl-20-oxahexacyclo[12.10.0.02,11.05,10.015,22.018,21]tetracos-11-ene-5-carboxylic acid |
| SMILES | CC1(C)CC[C@]2(C(=O)O)CC[C@]3(C)C(=CCC4[C@@]5(C)CC[C@@H]6[C@H]([C@@H]7OC(C#N)[C@@H](O)C(O)C7O)O[C@@]6(C)C5CC[C@]43C)C2C1 |
| InChI | InChI=1S/C36H53NO7/c1-31(2)13-15-36(30(41)42)16-14-33(4)19(21(36)17-31)7-8-23-32(3)11-9-20-28(29-27(40)26(39)25(38)22(18-37)43-29)44-35(20,6)24(32)10-12-34(23,33)5/h7,20-29,38-40H,8-17H2,1-6H3,(H,41,42)/t20-,21?,22?,23?,24?,25-,26?,27?,28-,29-,32-,33-,34-,35-,36+/m1/s1 |
| InChIKey | ROEMNJAXNVWYNR-GGIQCVDYSA-N |
| XLogP | 4.99 |
| TPSA | 140.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.82 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|