C42H32B2N2O — CID 174062519
CID 174062519 (PubChem CID 174062519) has the molecular formula C42H32B2N2O and a molecular weight of 602.36 g/mol.
| Compound Name | CID 174062519 |
|---|---|
| PubChem CID | 174062519 |
| Molecular Formula | C42H32B2N2O |
| Molecular Weight | 602.36 g/mol |
| Exact Mass | 602.27 |
| IUPAC Name | — |
| SMILES | [B]C(C)(C)c1cccc(C([B])(C)C)c1-c1ccnc(-c2cccc3c2oc2cc(-c4ccc(-c5ccccc5)cc4)c(C#N)cc23)c1 |
| InChI | InChI=1S/C42H32B2N2O/c1-41(2,43)35-14-9-15-36(42(3,4)44)39(35)29-20-21-46-37(23-29)32-13-8-12-31-34-22-30(25-45)33(24-38(34)47-40(31)32)28-18-16-27(17-19-28)26-10-6-5-7-11-26/h5-24H,1-4H3 |
| InChIKey | VLCWHKPMTFEWHL-UHFFFAOYSA-N |
| XLogP | 10.33 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.36 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|