C19H25N3O2S — CID 17406413
1-[2-(2,5-dimethylphenyl)sulfonylethyl]-4-pyridin-2-ylpiperazine (PubChem CID 17406413) has the molecular formula C19H25N3O2S and a molecular weight of 359.50 g/mol. Its IUPAC name is 1-[2-(2,5-dimethylphenyl)sulfonylethyl]-4-pyridin-2-ylpiperazine.
| Compound Name | 1-[2-(2,5-dimethylphenyl)sulfonylethyl]-4-pyridin-2-ylpiperazine |
|---|---|
| PubChem CID | 17406413 |
| Molecular Formula | C19H25N3O2S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 1-[2-(2,5-dimethylphenyl)sulfonylethyl]-4-pyridin-2-ylpiperazine |
| SMILES | Cc1ccc(C)c(S(=O)(=O)CCN2CCN(c3ccccn3)CC2)c1 |
| InChI | InChI=1S/C19H25N3O2S/c1-16-6-7-17(2)18(15-16)25(23,24)14-13-21-9-11-22(12-10-21)19-5-3-4-8-20-19/h3-8,15H,9-14H2,1-2H3 |
| InChIKey | JCXNXBRRNBPJHU-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |