C30H33N3O3 — CID 174064988
ethyl 4-[1-amino-3-phenylmethoxyimino-3-(3-phenylphenyl)prop-1-en-2-yl]piperidine-1-carboxylate (PubChem CID 174064988) has the molecular formula C30H33N3O3 and a molecular weight of 483.61 g/mol. Its IUPAC name is ethyl 4-[1-amino-3-phenylmethoxyimino-3-(3-phenylphenyl)prop-1-en-2-yl]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[1-amino-3-phenylmethoxyimino-3-(3-phenylphenyl)prop-1-en-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 174064988 |
| Molecular Formula | C30H33N3O3 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | ethyl 4-[1-amino-3-phenylmethoxyimino-3-(3-phenylphenyl)prop-1-en-2-yl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(C(=CN)C(=NOCc2ccccc2)c2cccc(-c3ccccc3)c2)CC1 |
| InChI | InChI=1S/C30H33N3O3/c1-2-35-30(34)33-18-16-25(17-19-33)28(21-31)29(32-36-22-23-10-5-3-6-11-23)27-15-9-14-26(20-27)24-12-7-4-8-13-24/h3-15,20-21,25H,2,16-19,22,31H2,1H3 |
| InChIKey | HEWNSCDAWQCDCO-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|