C21H29N3O4S — CID 17406570
N-[5-(dimethylsulfamoyl)-2-methoxyphenyl]-2-[(2-methyl-1-phenylpropyl)amino]acetamide (PubChem CID 17406570) has the molecular formula C21H29N3O4S and a molecular weight of 419.55 g/mol. Its IUPAC name is N-[5-(dimethylsulfamoyl)-2-methoxyphenyl]-2-[(2-methyl-1-phenylpropyl)amino]acetamide.
| Compound Name | N-[5-(dimethylsulfamoyl)-2-methoxyphenyl]-2-[(2-methyl-1-phenylpropyl)amino]acetamide |
|---|---|
| PubChem CID | 17406570 |
| Molecular Formula | C21H29N3O4S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | N-[5-(dimethylsulfamoyl)-2-methoxyphenyl]-2-[(2-methyl-1-phenylpropyl)amino]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(C)C)cc1NC(=O)CNC(c1ccccc1)C(C)C |
| InChI | InChI=1S/C21H29N3O4S/c1-15(2)21(16-9-7-6-8-10-16)22-14-20(25)23-18-13-17(11-12-19(18)28-5)29(26,27)24(3)4/h6-13,15,21-22H,14H2,1-5H3,(H,23,25) |
| InChIKey | ACLLXSVBXKRHDW-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |