C42H46N4O4 — CID 174065874
5-oxo-2-[3-oxo-7-(4-piperidin-1-ylpiperidin-1-yl)-1H-isoindol-2-yl]-5-(tritylamino)pentanoic acid (PubChem CID 174065874) has the molecular formula C42H46N4O4 and a molecular weight of 670.85 g/mol. Its IUPAC name is 5-oxo-2-[3-oxo-7-(4-piperidin-1-ylpiperidin-1-yl)-1H-isoindol-2-yl]-5-(tritylamino)pentanoic acid.
| Compound Name | 5-oxo-2-[3-oxo-7-(4-piperidin-1-ylpiperidin-1-yl)-1H-isoindol-2-yl]-5-(tritylamino)pentanoic acid |
|---|---|
| PubChem CID | 174065874 |
| Molecular Formula | C42H46N4O4 |
| Molecular Weight | 670.85 g/mol |
| Exact Mass | 670.35 |
| IUPAC Name | 5-oxo-2-[3-oxo-7-(4-piperidin-1-ylpiperidin-1-yl)-1H-isoindol-2-yl]-5-(tritylamino)pentanoic acid |
| SMILES | O=C(CCC(C(=O)O)N1Cc2c(cccc2N2CCC(N3CCCCC3)CC2)C1=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C42H46N4O4/c47-39(43-42(31-14-5-1-6-15-31,32-16-7-2-8-17-32)33-18-9-3-10-19-33)23-22-38(41(49)50)46-30-36-35(40(46)48)20-13-21-37(36)45-28-24-34(25-29-45)44-26-11-4-12-27-44/h1-3,5-10,13-21,34,38H,4,11-12,22-30H2,(H,43,47)(H,49,50) |
| InChIKey | FFDCHOXKCSANQW-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.85 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|