C22H20BN3O — CID 174067474
CID 174067474 (PubChem CID 174067474) has the molecular formula C22H20BN3O and a molecular weight of 353.23 g/mol.
| Compound Name | CID 174067474 |
|---|---|
| PubChem CID | 174067474 |
| Molecular Formula | C22H20BN3O |
| Molecular Weight | 353.23 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | — |
| SMILES | [B]C(C)(C)N1c2ncccc2N(c2cccc3c2oc2ccccc23)C1C |
| InChI | InChI=1S/C22H20BN3O/c1-14-25(18-11-7-13-24-21(18)26(14)22(2,3)23)17-10-6-9-16-15-8-4-5-12-19(15)27-20(16)17/h4-14H,1-3H3 |
| InChIKey | GFOHXJJRJSLRTI-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 32.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.23 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|