C23H31BFNO4S — CID 174067630
[(3R,5R)-3-fluoro-5-methylpiperidin-1-yl]-[4-methoxy-3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzothiophen-6-yl]methanone (PubChem CID 174067630) has the molecular formula C23H31BFNO4S and a molecular weight of 447.38 g/mol. Its IUPAC name is [(3R,5R)-3-fluoro-5-methylpiperidin-1-yl]-[4-methoxy-3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzothiophen-6-yl]methanone.
| Compound Name | [(3R,5R)-3-fluoro-5-methylpiperidin-1-yl]-[4-methoxy-3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzothiophen-6-yl]methanone |
|---|---|
| PubChem CID | 174067630 |
| Molecular Formula | C23H31BFNO4S |
| Molecular Weight | 447.38 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | [(3R,5R)-3-fluoro-5-methylpiperidin-1-yl]-[4-methoxy-3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzothiophen-6-yl]methanone |
| SMILES | COc1cc(C(=O)N2C[C@H](C)C[C@@H](F)C2)cc2sc(B3OC(C)(C)C(C)(C)O3)c(C)c12 |
| InChI | InChI=1S/C23H31BFNO4S/c1-13-8-16(25)12-26(11-13)21(27)15-9-17(28-7)19-14(2)20(31-18(19)10-15)24-29-22(3,4)23(5,6)30-24/h9-10,13,16H,8,11-12H2,1-7H3/t13-,16-/m1/s1 |
| InChIKey | PRTVKGMQCKOUOD-CZUORRHYSA-N |
| XLogP | 4.34 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.38 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|