C22H21F3N6O — CID 174069285
1-[3-[2-(piperidin-3-ylideneamino)-5-(trifluoromethyl)pyrimidin-4-yl]-1H-indol-6-yl]pyrrolidin-2-one (PubChem CID 174069285) has the molecular formula C22H21F3N6O and a molecular weight of 442.45 g/mol. Its IUPAC name is 1-[3-[2-(piperidin-3-ylideneamino)-5-(trifluoromethyl)pyrimidin-4-yl]-1H-indol-6-yl]pyrrolidin-2-one.
| Compound Name | 1-[3-[2-(piperidin-3-ylideneamino)-5-(trifluoromethyl)pyrimidin-4-yl]-1H-indol-6-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 174069285 |
| Molecular Formula | C22H21F3N6O |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 1-[3-[2-(piperidin-3-ylideneamino)-5-(trifluoromethyl)pyrimidin-4-yl]-1H-indol-6-yl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1c1ccc2c(-c3nc(N=C4CCCNC4)ncc3C(F)(F)F)c[nH]c2c1 |
| InChI | InChI=1S/C22H21F3N6O/c23-22(24,25)17-12-28-21(29-13-3-1-7-26-10-13)30-20(17)16-11-27-18-9-14(5-6-15(16)18)31-8-2-4-19(31)32/h5-6,9,11-12,26-27H,1-4,7-8,10H2 |
| InChIKey | UEOXSJPQVZKAFJ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|