C30H24O2 — CID 174070072
14-methyl-5,8-diphenyltetracyclo[7.6.2.04,17.012,16]heptadeca-1(15),3,9,12(16),13-pentaene-6,7-dione (PubChem CID 174070072) has the molecular formula C30H24O2 and a molecular weight of 416.52 g/mol. Its IUPAC name is 14-methyl-5,8-diphenyltetracyclo[7.6.2.04,17.012,16]heptadeca-1(15),3,9,12(16),13-pentaene-6,7-dione.
| Compound Name | 14-methyl-5,8-diphenyltetracyclo[7.6.2.04,17.012,16]heptadeca-1(15),3,9,12(16),13-pentaene-6,7-dione |
|---|---|
| PubChem CID | 174070072 |
| Molecular Formula | C30H24O2 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 14-methyl-5,8-diphenyltetracyclo[7.6.2.04,17.012,16]heptadeca-1(15),3,9,12(16),13-pentaene-6,7-dione |
| SMILES | Cc1cc2c3c(c1)CC=C1C(c4ccccc4)C(=O)C(=O)C(c4ccccc4)C(=CC2)C13 |
| InChI | InChI=1S/C30H24O2/c1-18-16-21-12-14-23-26(19-8-4-2-5-9-19)29(31)30(32)27(20-10-6-3-7-11-20)24-15-13-22(17-18)25(21)28(23)24/h2-11,14-17,26-28H,12-13H2,1H3 |
| InChIKey | RXCMPVCIDQURGZ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|