C26H18BNO4S — CID 174070723
CID 174070723 (PubChem CID 174070723) has the molecular formula C26H18BNO4S and a molecular weight of 451.31 g/mol.
| Compound Name | CID 174070723 |
|---|---|
| PubChem CID | 174070723 |
| Molecular Formula | C26H18BNO4S |
| Molecular Weight | 451.31 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | — |
| SMILES | [B]c1c(C)c(O)c2c(c1C)c1c(O)c(O)c(O)cc1n2-c1cccc2c1sc1ccccc12 |
| InChI | InChI=1S/C26H18BNO4S/c1-11-19-20-16(10-17(29)24(31)25(20)32)28(22(19)23(30)12(2)21(11)27)15-8-5-7-14-13-6-3-4-9-18(13)33-26(14)15/h3-10,29-32H,1-2H3 |
| InChIKey | GILAIRLQLHQILK-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 85.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.31 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|