C27H41N7O2 — CID 174070911
(6R)-4-[amino-[4-[(2S)-2-methyl-1,4-diazepan-1-yl]-6-(4-methylpiperazin-1-yl)pyrimidin-2-yl]methylidene]spiro[5.5]undecane-5,11-dione (PubChem CID 174070911) has the molecular formula C27H41N7O2 and a molecular weight of 495.67 g/mol. Its IUPAC name is (6R)-4-[amino-[4-[(2S)-2-methyl-1,4-diazepan-1-yl]-6-(4-methylpiperazin-1-yl)pyrimidin-2-yl]methylidene]spiro[5.5]undecane-5,11-dione.
| Compound Name | (6R)-4-[amino-[4-[(2S)-2-methyl-1,4-diazepan-1-yl]-6-(4-methylpiperazin-1-yl)pyrimidin-2-yl]methylidene]spiro[5.5]undecane-5,11-dione |
|---|---|
| PubChem CID | 174070911 |
| Molecular Formula | C27H41N7O2 |
| Molecular Weight | 495.67 g/mol |
| Exact Mass | 495.33 |
| IUPAC Name | (6R)-4-[amino-[4-[(2S)-2-methyl-1,4-diazepan-1-yl]-6-(4-methylpiperazin-1-yl)pyrimidin-2-yl]methylidene]spiro[5.5]undecane-5,11-dione |
| SMILES | C[C@H]1CNCCCN1c1cc(N2CCN(C)CC2)nc(C(N)=C2CCC[C@@]3(CCCCC3=O)C2=O)n1 |
| InChI | InChI=1S/C27H41N7O2/c1-19-18-29-11-6-12-34(19)23-17-22(33-15-13-32(2)14-16-33)30-26(31-23)24(28)20-7-5-10-27(25(20)36)9-4-3-8-21(27)35/h17,19,29H,3-16,18,28H2,1-2H3/t19-,27+/m0/s1 |
| InChIKey | VGWYSEFCZUZKOZ-UZTOHYMASA-N |
| XLogP | 1.97 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.67 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|