C21H34N4O5S — CID 174072025
methyl (2R,3S,5R)-2-[[(1R,3R,4R)-3,4-dimethyl-4-pyrimidin-2-ylcyclohexyl]oxymethyl]-3-(methanesulfonamido)-5-methylpyrrolidine-1-carboxylate (PubChem CID 174072025) has the molecular formula C21H34N4O5S and a molecular weight of 454.59 g/mol. Its IUPAC name is methyl (2R,3S,5R)-2-[[(1R,3R,4R)-3,4-dimethyl-4-pyrimidin-2-ylcyclohexyl]oxymethyl]-3-(methanesulfonamido)-5-methylpyrrolidine-1-carboxylate.
| Compound Name | methyl (2R,3S,5R)-2-[[(1R,3R,4R)-3,4-dimethyl-4-pyrimidin-2-ylcyclohexyl]oxymethyl]-3-(methanesulfonamido)-5-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 174072025 |
| Molecular Formula | C21H34N4O5S |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | methyl (2R,3S,5R)-2-[[(1R,3R,4R)-3,4-dimethyl-4-pyrimidin-2-ylcyclohexyl]oxymethyl]-3-(methanesulfonamido)-5-methylpyrrolidine-1-carboxylate |
| SMILES | COC(=O)N1[C@H](C)C[C@H](NS(C)(=O)=O)[C@@H]1CO[C@@H]1CC[C@@](C)(c2ncccn2)[C@H](C)C1 |
| InChI | InChI=1S/C21H34N4O5S/c1-14-11-16(7-8-21(14,3)19-22-9-6-10-23-19)30-13-18-17(24-31(5,27)28)12-15(2)25(18)20(26)29-4/h6,9-10,14-18,24H,7-8,11-13H2,1-5H3/t14-,15-,16-,17+,18+,21-/m1/s1 |
| InChIKey | CJUQZXGGZZHLEB-PMLPCWDUSA-N |
| XLogP | 2.09 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |