C21H18BClF6N4O3 — CID 174072278
CID 174072278 (PubChem CID 174072278) has the molecular formula C21H18BClF6N4O3 and a molecular weight of 534.65 g/mol.
| Compound Name | CID 174072278 |
|---|---|
| PubChem CID | 174072278 |
| Molecular Formula | C21H18BClF6N4O3 |
| Molecular Weight | 534.65 g/mol |
| Exact Mass | 534.11 |
| IUPAC Name | — |
| SMILES | [B][C@@](C(=O)NC1CCC(F)(F)CC1)(c1cncnc1)N(C(=O)[C@H](F)Cl)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C21H18BClF6N4O3/c22-20(12-9-30-11-31-10-12,18(35)32-13-5-7-19(25,26)8-6-13)33(17(34)16(23)24)14-1-3-15(4-2-14)36-21(27,28)29/h1-4,9-11,13,16H,5-8H2,(H,32,35)/t16-,20-/m0/s1 |
| InChIKey | PCRLLKVRCZBICM-JXFKEZNVSA-N |
| XLogP | 3.96 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.65 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|