C27H22B2N2O — CID 174072504
CID 174072504 (PubChem CID 174072504) has the molecular formula C27H22B2N2O and a molecular weight of 412.11 g/mol.
| Compound Name | CID 174072504 |
|---|---|
| PubChem CID | 174072504 |
| Molecular Formula | C27H22B2N2O |
| Molecular Weight | 412.11 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | — |
| SMILES | [B]C([B])(c1ccnc(-c2cccc3c2oc2nc4ccccc4cc23)c1)C1CCCCC1 |
| InChI | InChI=1S/C27H22B2N2O/c28-27(29,18-8-2-1-3-9-18)19-13-14-30-24(16-19)21-11-6-10-20-22-15-17-7-4-5-12-23(17)31-26(22)32-25(20)21/h4-7,10-16,18H,1-3,8-9H2 |
| InChIKey | DQEZVRHIGXTTNO-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.11 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|