C48H22B10N4O — CID 174072867
CID 174072867 (PubChem CID 174072867) has the molecular formula C48H22B10N4O and a molecular weight of 778.85 g/mol.
| Compound Name | CID 174072867 |
|---|---|
| PubChem CID | 174072867 |
| Molecular Formula | C48H22B10N4O |
| Molecular Weight | 778.85 g/mol |
| Exact Mass | 780.27 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c2c(oc3c2c([B])c([B])c2c4c([B])c([B])c([B])c([B])c4n(-c4cccc(-c5nc(-c6ccccc6)nc(-c6ccc7c(c6)C(C)(C)c6ccccc6-7)n5)c4)c32)c1[B] |
| InChI | InChI=1S/C48H22B10N4O/c1-48(2)25-14-7-6-13-23(25)24-16-15-21(18-26(24)48)47-60-45(19-9-4-3-5-10-19)59-46(61-47)20-11-8-12-22(17-20)62-41-27(32(50)35(53)37(55)39(41)57)28-31(49)33(51)30-29-34(52)36(54)38(56)40(58)43(29)63-44(30)42(28)62/h3-18H,1-2H3 |
| InChIKey | AYCOCOFVKBRJAJ-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 63 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.85 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|