C39H18B7N3S — CID 174073285
CID 174073285 (PubChem CID 174073285) has the molecular formula C39H18B7N3S and a molecular weight of 636.35 g/mol.
| Compound Name | CID 174073285 |
|---|---|
| PubChem CID | 174073285 |
| Molecular Formula | C39H18B7N3S |
| Molecular Weight | 636.35 g/mol |
| Exact Mass | 637.19 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c2c(sc3c([B])c([B])c([B])c(-c4nc(-c5ccc(-c6ccccc6)cc5)nc(-c5cccc(-c6ccccc6)c5)n4)c32)c1[B] |
| InChI | InChI=1S/C39H18B7N3S/c40-28-26-25-27(29(41)31(43)33(45)35(25)50-36(26)34(46)32(44)30(28)42)39-48-37(22-16-14-21(15-17-22)19-8-3-1-4-9-19)47-38(49-39)24-13-7-12-23(18-24)20-10-5-2-6-11-20/h1-18H |
| InChIKey | RZQMCKZBUNZTSJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.35 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|