C45H18B8N4O2 — CID 174073680
CID 174073680 (PubChem CID 174073680) has the molecular formula C45H18B8N4O2 and a molecular weight of 733.16 g/mol.
| Compound Name | CID 174073680 |
|---|---|
| PubChem CID | 174073680 |
| Molecular Formula | C45H18B8N4O2 |
| Molecular Weight | 733.16 g/mol |
| Exact Mass | 734.22 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c2c(c1[B])c1c([B])c([B])c([B])c([B])c1n2-c1nc(-c2ccccc2)nc(-c2ccc3c(c2)oc2ccc(-c4cccc5c4oc4ccccc45)cc23)n1 |
| InChI | InChI=1S/C45H18B8N4O2/c46-32-30-31-33(47)35(49)37(51)39(53)41(31)57(40(30)38(52)36(50)34(32)48)45-55-43(19-7-2-1-3-8-19)54-44(56-45)21-13-15-24-26-17-20(14-16-28(26)58-29(24)18-21)22-10-6-11-25-23-9-4-5-12-27(23)59-42(22)25/h1-18H |
| InChIKey | SXELTTPWLKBORL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 69.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 59 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.16 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|