C55H40B7N — CID 174074109
CID 174074109 (PubChem CID 174074109) has the molecular formula C55H40B7N and a molecular weight of 790.62 g/mol.
| Compound Name | CID 174074109 |
|---|---|
| PubChem CID | 174074109 |
| Molecular Formula | C55H40B7N |
| Molecular Weight | 790.62 g/mol |
| Exact Mass | 791.38 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c2c(c1[B])-c1c([B])c([B])c(N(c3ccccc3)c3ccccc3-c3cc4c(cc3-c3ccccc3)C3(c5ccccc5-4)C4CC5CC(C4)CC3C5)c([B])c1C2(C)C |
| InChI | InChI=1S/C55H40B7N/c1-54(2)44-42(46(56)50(60)51(61)48(44)58)43-45(54)49(59)53(52(62)47(43)57)63(33-15-7-4-8-16-33)41-20-12-10-18-35(41)37-26-38-34-17-9-11-19-39(34)55(31-22-28-21-29(24-31)25-32(55)23-28)40(38)27-36(37)30-13-5-3-6-14-30/h3-20,26-29,31-32H,21-25H2,1-2H3 |
| InChIKey | MJNCYCDUHRKWCN-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.62 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|