C34H34B2ClFN6O2 — CID 174074595
CID 174074595 (PubChem CID 174074595) has the molecular formula C34H34B2ClFN6O2 and a molecular weight of 634.76 g/mol.
| Compound Name | CID 174074595 |
|---|---|
| PubChem CID | 174074595 |
| Molecular Formula | C34H34B2ClFN6O2 |
| Molecular Weight | 634.76 g/mol |
| Exact Mass | 634.26 |
| IUPAC Name | — |
| SMILES | [B]C([B])=Cc1cccc(F)c1-c1nc2c(cc1Cl)c(N1[C@@H](C)CN(C(=O)C=C)C[C@@H]1C)nc(=O)n2-c1c(CC)ccnc1C(C)C |
| InChI | InChI=1S/C34H34B2ClFN6O2/c1-7-21-12-13-39-29(18(3)4)31(21)44-32-23(15-24(37)30(40-32)28-22(14-26(35)36)10-9-11-25(28)38)33(41-34(44)46)43-19(5)16-42(17-20(43)6)27(45)8-2/h8-15,18-20H,2,7,16-17H2,1,3-6H3/t19-,20-/m0/s1 |
| InChIKey | OOFVDENQYAYPLV-PMACEKPBSA-N |
| XLogP | 5.57 |
| TPSA | 84.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.76 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|