C33H30B4ClFN6O2 — CID 174075149
CID 174075149 (PubChem CID 174075149) has the molecular formula C33H30B4ClFN6O2 and a molecular weight of 640.34 g/mol.
| Compound Name | CID 174075149 |
|---|---|
| PubChem CID | 174075149 |
| Molecular Formula | C33H30B4ClFN6O2 |
| Molecular Weight | 640.34 g/mol |
| Exact Mass | 640.25 |
| IUPAC Name | — |
| SMILES | [B]/C=C(\[B])C(=O)N1CCN(c2nc(=O)n(-c3c(CC)ccnc3C(C)C)c3nc(-c4c(F)cccc4C=C([B])[B])c(Cl)cc23)[C@@H](C)C1 |
| InChI | InChI=1S/C33H30B4ClFN6O2/c1-5-19-9-10-40-27(17(2)3)29(19)45-31-21(14-23(38)28(41-31)26-20(13-25(36)37)7-6-8-24(26)39)30(42-33(45)47)44-12-11-43(16-18(44)4)32(46)22(35)15-34/h6-10,13-15,17-18H,5,11-12,16H2,1-4H3/b22-15-/t18-/m0/s1 |
| InChIKey | JCCHNWVLAMHOKL-CEZZIEKDSA-N |
| XLogP | 4.17 |
| TPSA | 84.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.34 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|