About CID 174074952
CID 174074952 (PubChem CID 174074952) has the molecular formula C43H18B7N3O2
and a molecular weight of 684.32 g/mol.
Molecular Properties
| Compound Name | CID 174074952 |
| PubChem CID | 174074952 |
| Molecular Formula | C43H18B7N3O2 |
| Molecular Weight | 684.32 g/mol |
| Exact Mass | 685.21 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c2c(oc3c([B])c([B])c([B])c(-c4cccc5c(-c6nc(-c7ccccc7)nc(-c7cccc8oc9ccccc9c78)n6)cccc45)c32)c1[B] |
| InChI | InChI=1S/C43H18B7N3O2/c44-32-29(30-31-33(45)34(46)36(48)38(50)40(31)55-39(30)37(49)35(32)47)22-14-6-13-21-20(22)12-7-15-23(21)42-51-41(19-9-2-1-3-10-19)52-43(53-42)25-16-8-18-27-28(25)24-11-4-5-17-26(24)54-27/h1-18H |
| InChIKey | QJYWAZONJNLBPN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 64.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 55 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 684.32 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 174074952 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174074952?
The IUPAC name of CID 174074952 (CID 174074952) is not available.
What is the SMILES notation for CID 174074952?
The canonical SMILES for CID 174074952 is [B]c1c([B])c([B])c2c(oc3c([B])c([B])c([B])c(-c4cccc5c(-c6nc(-c7ccccc7)nc(-c7cccc8oc9ccccc9c78)n6)cccc45)c32)c1[B].
What is the InChIKey of CID 174074952?
The InChIKey is QJYWAZONJNLBPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C43H18B7N3O2/c44-32-29(30-31-33(45)34(46)36(48)38(50)40(31)55-39(30)37(49)35(32)47)22-14-6-13-21-20(22)12-7-15-23(21)42-51-41(19-9-2-1-3-10-19)52-43(53-42)25-16-8-18-27-28(25)24-11-4-5-17-26(24)54-27/h1-18H.
What are the key properties of CID 174074952?
CID 174074952 has a molecular weight of 684.32 g/mol, XLogP of 3.05, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174074952 is sourced from PubChem (CID 174074952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).