C21H23FN4O2 — CID 174077038
2-[(2R,3R)-3-ethynyl-2-[(4-fluorophenyl)methyl]pyrrolidin-1-yl]-4-morpholin-4-yl-1H-pyrimidin-6-one (PubChem CID 174077038) has the molecular formula C21H23FN4O2 and a molecular weight of 382.44 g/mol. Its IUPAC name is 2-[(2R,3R)-3-ethynyl-2-[(4-fluorophenyl)methyl]pyrrolidin-1-yl]-4-morpholin-4-yl-1H-pyrimidin-6-one.
| Compound Name | 2-[(2R,3R)-3-ethynyl-2-[(4-fluorophenyl)methyl]pyrrolidin-1-yl]-4-morpholin-4-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 174077038 |
| Molecular Formula | C21H23FN4O2 |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 2-[(2R,3R)-3-ethynyl-2-[(4-fluorophenyl)methyl]pyrrolidin-1-yl]-4-morpholin-4-yl-1H-pyrimidin-6-one |
| SMILES | C#C[C@H]1CCN(c2nc(N3CCOCC3)cc(=O)[nH]2)[C@@H]1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C21H23FN4O2/c1-2-16-7-8-26(18(16)13-15-3-5-17(22)6-4-15)21-23-19(14-20(27)24-21)25-9-11-28-12-10-25/h1,3-6,14,16,18H,7-13H2,(H,23,24,27)/t16-,18+/m0/s1 |
| InChIKey | OUGBEEPCQMFHPV-FUHWJXTLSA-N |
| XLogP | 1.82 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|