C41H36N4 — CID 174077483
3-[(3R,7S)-3,7-dimethyl-1-bicyclo[3.3.1]nonanyl]-5-(4,6-dinaphthalen-2-yl-1,3,5-triazin-2-yl)benzonitrile (PubChem CID 174077483) has the molecular formula C41H36N4 and a molecular weight of 584.77 g/mol. Its IUPAC name is 3-[(3R,7S)-3,7-dimethyl-1-bicyclo[3.3.1]nonanyl]-5-(4,6-dinaphthalen-2-yl-1,3,5-triazin-2-yl)benzonitrile.
| Compound Name | 3-[(3R,7S)-3,7-dimethyl-1-bicyclo[3.3.1]nonanyl]-5-(4,6-dinaphthalen-2-yl-1,3,5-triazin-2-yl)benzonitrile |
|---|---|
| PubChem CID | 174077483 |
| Molecular Formula | C41H36N4 |
| Molecular Weight | 584.77 g/mol |
| Exact Mass | 584.29 |
| IUPAC Name | 3-[(3R,7S)-3,7-dimethyl-1-bicyclo[3.3.1]nonanyl]-5-(4,6-dinaphthalen-2-yl-1,3,5-triazin-2-yl)benzonitrile |
| SMILES | C[C@@H]1CC2C[C@H](C)CC(c3cc(C#N)cc(-c4nc(-c5ccc6ccccc6c5)nc(-c5ccc6ccccc6c5)n4)c3)(C2)C1 |
| InChI | InChI=1S/C41H36N4/c1-26-15-28-16-27(2)23-41(22-26,24-28)37-18-29(25-42)17-36(21-37)40-44-38(34-13-11-30-7-3-5-9-32(30)19-34)43-39(45-40)35-14-12-31-8-4-6-10-33(31)20-35/h3-14,17-21,26-28H,15-16,22-24H2,1-2H3/t26-,27+,28?,41? |
| InChIKey | OZHOZPUJYWIFBI-AOEBXXOPSA-N |
| XLogP | 10.15 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.77 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |