C50H54N4 — CID 174078148
4-[4-[4,6-bis[4-[(3R,7S)-3,7-dimethyl-1-bicyclo[3.3.1]nonanyl]phenyl]-1,3,5-triazin-2-yl]phenyl]benzonitrile (PubChem CID 174078148) has the molecular formula C50H54N4 and a molecular weight of 711.01 g/mol. Its IUPAC name is 4-[4-[4,6-bis[4-[(3R,7S)-3,7-dimethyl-1-bicyclo[3.3.1]nonanyl]phenyl]-1,3,5-triazin-2-yl]phenyl]benzonitrile.
| Compound Name | 4-[4-[4,6-bis[4-[(3R,7S)-3,7-dimethyl-1-bicyclo[3.3.1]nonanyl]phenyl]-1,3,5-triazin-2-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 174078148 |
| Molecular Formula | C50H54N4 |
| Molecular Weight | 711.01 g/mol |
| Exact Mass | 710.43 |
| IUPAC Name | 4-[4-[4,6-bis[4-[(3R,7S)-3,7-dimethyl-1-bicyclo[3.3.1]nonanyl]phenyl]-1,3,5-triazin-2-yl]phenyl]benzonitrile |
| SMILES | C[C@@H]1CC2C[C@H](C)CC(c3ccc(-c4nc(-c5ccc(-c6ccc(C#N)cc6)cc5)nc(-c5ccc(C67CC(C[C@@H](C)C6)C[C@H](C)C7)cc5)n4)cc3)(C2)C1 |
| InChI | InChI=1S/C50H54N4/c1-32-21-37-22-33(2)26-49(25-32,29-37)44-17-13-42(14-18-44)47-52-46(41-11-9-40(10-12-41)39-7-5-36(31-51)6-8-39)53-48(54-47)43-15-19-45(20-16-43)50-27-34(3)23-38(30-50)24-35(4)28-50/h5-20,32-35,37-38H,21-30H2,1-4H3/t32-,33+,34-,35+,37?,38?,49?,50? |
| InChIKey | CVVHITBCRJYTCN-CXFIKEDKSA-N |
| XLogP | 12.62 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.01 |
| LogP ≤ 5 | 12.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |