C53H44N4 — CID 174078676
4-[4-[8-[4-[(3R,7S)-3,7-dimethyl-1-bicyclo[3.3.1]nonanyl]phenyl]phenanthren-3-yl]-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]benzonitrile (PubChem CID 174078676) has the molecular formula C53H44N4 and a molecular weight of 736.96 g/mol. Its IUPAC name is 4-[4-[8-[4-[(3R,7S)-3,7-dimethyl-1-bicyclo[3.3.1]nonanyl]phenyl]phenanthren-3-yl]-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]benzonitrile.
| Compound Name | 4-[4-[8-[4-[(3R,7S)-3,7-dimethyl-1-bicyclo[3.3.1]nonanyl]phenyl]phenanthren-3-yl]-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 174078676 |
| Molecular Formula | C53H44N4 |
| Molecular Weight | 736.96 g/mol |
| Exact Mass | 736.36 |
| IUPAC Name | 4-[4-[8-[4-[(3R,7S)-3,7-dimethyl-1-bicyclo[3.3.1]nonanyl]phenyl]phenanthren-3-yl]-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]benzonitrile |
| SMILES | C[C@@H]1CC2C[C@H](C)CC(c3ccc(-c4cccc5c4ccc4ccc(-c6nc(-c7ccc(C#N)cc7)nc(-c7ccc(-c8ccccc8)cc7)n6)cc45)cc3)(C2)C1 |
| InChI | InChI=1S/C53H44N4/c1-34-27-37-28-35(2)31-53(30-34,32-37)45-24-21-40(22-25-45)46-9-6-10-47-48(46)26-23-41-17-20-44(29-49(41)47)52-56-50(42-13-11-36(33-54)12-14-42)55-51(57-52)43-18-15-39(16-19-43)38-7-4-3-5-8-38/h3-26,29,34-35,37H,27-28,30-32H2,1-2H3/t34-,35+,37?,53? |
| InChIKey | XJEWZQWCPTWIEL-NHIUJQPNSA-N |
| XLogP | 13.49 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.96 |
| LogP ≤ 5 | 13.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|