C46H42N4 — CID 174077712
4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-[3-[(3R,5S,7S)-3-ethyl-7-methyl-1-bicyclo[3.3.1]nonanyl]phenyl]benzonitrile (PubChem CID 174077712) has the molecular formula C46H42N4 and a molecular weight of 650.87 g/mol. Its IUPAC name is 4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-[3-[(3R,5S,7S)-3-ethyl-7-methyl-1-bicyclo[3.3.1]nonanyl]phenyl]benzonitrile.
| Compound Name | 4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-[3-[(3R,5S,7S)-3-ethyl-7-methyl-1-bicyclo[3.3.1]nonanyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 174077712 |
| Molecular Formula | C46H42N4 |
| Molecular Weight | 650.87 g/mol |
| Exact Mass | 650.34 |
| IUPAC Name | 4-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-3-[3-[(3R,5S,7S)-3-ethyl-7-methyl-1-bicyclo[3.3.1]nonanyl]phenyl]benzonitrile |
| SMILES | CC[C@@H]1C[C@@H]2C[C@H](C)CC(c3cccc(-c4cc(C#N)ccc4-c4cccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)c4)c3)(C1)C2 |
| InChI | InChI=1S/C46H42N4/c1-3-32-23-34-22-31(2)27-46(28-32,29-34)40-19-11-17-38(26-40)42-24-33(30-47)20-21-41(42)37-16-10-18-39(25-37)45-49-43(35-12-6-4-7-13-35)48-44(50-45)36-14-8-5-9-15-36/h4-21,24-26,31-32,34H,3,22-23,27-29H2,1-2H3/t31-,32+,34-,46?/m0/s1 |
| InChIKey | YYBNFVBRWGIUAE-VCWQTOBBSA-N |
| XLogP | 11.57 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.87 |
| LogP ≤ 5 | 11.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |