C42H38N4 — CID 174077624
4-[4-[7-[(3R,5S,7S)-3-ethyl-7-methyl-1-bicyclo[3.3.1]nonanyl]phenanthren-2-yl]-6-phenyl-1,3,5-triazin-2-yl]benzonitrile (PubChem CID 174077624) has the molecular formula C42H38N4 and a molecular weight of 598.79 g/mol. Its IUPAC name is 4-[4-[7-[(3R,5S,7S)-3-ethyl-7-methyl-1-bicyclo[3.3.1]nonanyl]phenanthren-2-yl]-6-phenyl-1,3,5-triazin-2-yl]benzonitrile.
| Compound Name | 4-[4-[7-[(3R,5S,7S)-3-ethyl-7-methyl-1-bicyclo[3.3.1]nonanyl]phenanthren-2-yl]-6-phenyl-1,3,5-triazin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 174077624 |
| Molecular Formula | C42H38N4 |
| Molecular Weight | 598.79 g/mol |
| Exact Mass | 598.31 |
| IUPAC Name | 4-[4-[7-[(3R,5S,7S)-3-ethyl-7-methyl-1-bicyclo[3.3.1]nonanyl]phenanthren-2-yl]-6-phenyl-1,3,5-triazin-2-yl]benzonitrile |
| SMILES | CC[C@@H]1C[C@@H]2C[C@H](C)CC(c3ccc4c(ccc5cc(-c6nc(-c7ccccc7)nc(-c7ccc(C#N)cc7)n6)ccc54)c3)(C1)C2 |
| InChI | InChI=1S/C42H38N4/c1-3-28-20-30-19-27(2)23-42(24-28,25-30)36-16-18-38-34(22-36)14-13-33-21-35(15-17-37(33)38)41-45-39(31-7-5-4-6-8-31)44-40(46-41)32-11-9-29(26-43)10-12-32/h4-18,21-22,27-28,30H,3,19-20,23-25H2,1-2H3/t27-,28+,30-,42?/m0/s1 |
| InChIKey | REYWMZODWRUMPK-MWKJFAHVSA-N |
| XLogP | 10.54 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.79 |
| LogP ≤ 5 | 10.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|