C16H31N3O2 — CID 174077948
4-[[3-amino-3-(3-methoxy-2,2-dimethylpropoxy)-2-methylprop-2-enylidene]amino]cyclohexan-1-amine (PubChem CID 174077948) has the molecular formula C16H31N3O2 and a molecular weight of 297.44 g/mol. Its IUPAC name is 4-[[3-amino-3-(3-methoxy-2,2-dimethylpropoxy)-2-methylprop-2-enylidene]amino]cyclohexan-1-amine.
| Compound Name | 4-[[3-amino-3-(3-methoxy-2,2-dimethylpropoxy)-2-methylprop-2-enylidene]amino]cyclohexan-1-amine |
|---|---|
| PubChem CID | 174077948 |
| Molecular Formula | C16H31N3O2 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.24 |
| IUPAC Name | 4-[[3-amino-3-(3-methoxy-2,2-dimethylpropoxy)-2-methylprop-2-enylidene]amino]cyclohexan-1-amine |
| SMILES | COCC(C)(C)COC(N)=C(C)/C=N/C1CCC(N)CC1 |
| InChI | InChI=1S/C16H31N3O2/c1-12(9-19-14-7-5-13(17)6-8-14)15(18)21-11-16(2,3)10-20-4/h9,13-14H,5-8,10-11,17-18H2,1-4H3/b15-12?,19-9+ |
| InChIKey | ZEVZUADETIQGDA-RPABXMIHSA-N |
| XLogP | 2.21 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|