C13H24N4O — CID 165161617
1-[4-[[(E)-2,3-diaminoprop-2-enylidene]amino]piperidin-1-yl]-2,2-dimethylpropan-1-one (PubChem CID 165161617) has the molecular formula C13H24N4O and a molecular weight of 252.36 g/mol. Its IUPAC name is 1-[4-[[(E)-2,3-diaminoprop-2-enylidene]amino]piperidin-1-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[4-[[(E)-2,3-diaminoprop-2-enylidene]amino]piperidin-1-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 165161617 |
| Molecular Formula | C13H24N4O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | 1-[4-[[(E)-2,3-diaminoprop-2-enylidene]amino]piperidin-1-yl]-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)N1CCC(/N=C/C(N)=C\N)CC1 |
| InChI | InChI=1S/C13H24N4O/c1-13(2,3)12(18)17-6-4-11(5-7-17)16-9-10(15)8-14/h8-9,11H,4-7,14-15H2,1-3H3/b10-8+,16-9+ |
| InChIKey | ZJTCJPYCYUIACD-VYWHLGQJSA-N |
| XLogP | 0.85 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|