C16H28N2O — CID 176982992
(E)-1-amino-5,5-dimethyl-2-[(4-methylcyclohexyl)iminomethyl]hex-1-en-3-one (PubChem CID 176982992) has the molecular formula C16H28N2O and a molecular weight of 264.41 g/mol. Its IUPAC name is (E)-1-amino-5,5-dimethyl-2-[(4-methylcyclohexyl)iminomethyl]hex-1-en-3-one.
| Compound Name | (E)-1-amino-5,5-dimethyl-2-[(4-methylcyclohexyl)iminomethyl]hex-1-en-3-one |
|---|---|
| PubChem CID | 176982992 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | (E)-1-amino-5,5-dimethyl-2-[(4-methylcyclohexyl)iminomethyl]hex-1-en-3-one |
| SMILES | CC1CCC(/N=C/C(=C\N)C(=O)CC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H28N2O/c1-12-5-7-14(8-6-12)18-11-13(10-17)15(19)9-16(2,3)4/h10-12,14H,5-9,17H2,1-4H3/b13-10+,18-11+ |
| InChIKey | BEUIPMXNKJJHHU-HWVXOFFASA-N |
| XLogP | 3.48 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|