C12H18N4O2 — CID 174101306
tert-butyl 3-[(3-amino-2-cyanoprop-2-enylidene)amino]azetidine-1-carboxylate (PubChem CID 174101306) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is tert-butyl 3-[(3-amino-2-cyanoprop-2-enylidene)amino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(3-amino-2-cyanoprop-2-enylidene)amino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 174101306 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | tert-butyl 3-[(3-amino-2-cyanoprop-2-enylidene)amino]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(/N=C/C(C#N)=CN)C1 |
| InChI | InChI=1S/C12H18N4O2/c1-12(2,3)18-11(17)16-7-10(8-16)15-6-9(4-13)5-14/h4,6,10H,7-8,13H2,1-3H3/b9-4?,15-6+ |
| InChIKey | NJWWLDONUYSYLJ-QTYSZBRUSA-N |
| XLogP | 1.04 |
| TPSA | 91.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|