About (2E)-2-(1-chloroethylidene)-4,4-dimethylpentanal
(2E)-2-(1-chloroethylidene)-4,4-dimethylpentanal (PubChem CID 131408574) has the molecular formula C9H15ClO
and a molecular weight of 174.67 g/mol. Its IUPAC name is (2E)-2-(1-chloroethylidene)-4,4-dimethylpentanal.
Molecular Properties
| Compound Name | (2E)-2-(1-chloroethylidene)-4,4-dimethylpentanal |
| PubChem CID | 131408574 |
| Molecular Formula | C9H15ClO |
| Molecular Weight | 174.67 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | (2E)-2-(1-chloroethylidene)-4,4-dimethylpentanal |
| SMILES | C/C(Cl)=C(\C=O)CC(C)(C)C |
| InChI | InChI=1S/C9H15ClO/c1-7(10)8(6-11)5-9(2,3)4/h6H,5H2,1-4H3/b8-7+ |
| InChIKey | YIIMNYBSJNQNIR-BQYQJAHWSA-N |
| XLogP | 3.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.67 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-(1-chloroethylidene)-4,4-dimethylpentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-(1-chloroethylidene)-4,4-dimethylpentanal?
The IUPAC name of (2E)-2-(1-chloroethylidene)-4,4-dimethylpentanal (CID 131408574) is (2E)-2-(1-chloroethylidene)-4,4-dimethylpentanal.
What is the SMILES notation for (2E)-2-(1-chloroethylidene)-4,4-dimethylpentanal?
The canonical SMILES for (2E)-2-(1-chloroethylidene)-4,4-dimethylpentanal is C/C(Cl)=C(\C=O)CC(C)(C)C.
What is the InChIKey of (2E)-2-(1-chloroethylidene)-4,4-dimethylpentanal?
The InChIKey is YIIMNYBSJNQNIR-BQYQJAHWSA-N. The full InChI is InChI=1S/C9H15ClO/c1-7(10)8(6-11)5-9(2,3)4/h6H,5H2,1-4H3/b8-7+.
What are the key properties of (2E)-2-(1-chloroethylidene)-4,4-dimethylpentanal?
(2E)-2-(1-chloroethylidene)-4,4-dimethylpentanal has a molecular weight of 174.67 g/mol, XLogP of 3.13, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-(1-chloroethylidene)-4,4-dimethylpentanal is sourced from PubChem (CID 131408574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).