C10H18O4 — CID 88526122
2,2-dimethoxy-5,5-dimethyl-3-oxohexanal (PubChem CID 88526122) has the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. Its IUPAC name is 2,2-dimethoxy-5,5-dimethyl-3-oxohexanal.
| Compound Name | 2,2-dimethoxy-5,5-dimethyl-3-oxohexanal |
|---|---|
| PubChem CID | 88526122 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 2,2-dimethoxy-5,5-dimethyl-3-oxohexanal |
| SMILES | COC(C=O)(OC)C(=O)CC(C)(C)C |
| InChI | InChI=1S/C10H18O4/c1-9(2,3)6-8(12)10(7-11,13-4)14-5/h7H,6H2,1-5H3 |
| InChIKey | ZHTLPYFZCJRZSB-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|