C15H31NO — CID 89393611
7-amino-2,2,5,5,6,6,7-heptamethyloctan-4-one (PubChem CID 89393611) has the molecular formula C15H31NO and a molecular weight of 241.42 g/mol. Its IUPAC name is 7-amino-2,2,5,5,6,6,7-heptamethyloctan-4-one.
| Compound Name | 7-amino-2,2,5,5,6,6,7-heptamethyloctan-4-one |
|---|---|
| PubChem CID | 89393611 |
| Molecular Formula | C15H31NO |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.24 |
| IUPAC Name | 7-amino-2,2,5,5,6,6,7-heptamethyloctan-4-one |
| SMILES | CC(C)(C)CC(=O)C(C)(C)C(C)(C)C(C)(C)N |
| InChI | InChI=1S/C15H31NO/c1-12(2,3)10-11(17)13(4,5)14(6,7)15(8,9)16/h10,16H2,1-9H3 |
| InChIKey | RRPKZVHCTIJOEW-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |