C21H44O2 — CID 158142695
methane;2,2,5,5-tetramethylhexan-3-one;(E)-2,2,5,5-tetramethylhex-3-en-3-ol (PubChem CID 158142695) has the molecular formula C21H44O2 and a molecular weight of 328.58 g/mol. Its IUPAC name is methane;2,2,5,5-tetramethylhexan-3-one;(E)-2,2,5,5-tetramethylhex-3-en-3-ol.
| Compound Name | methane;2,2,5,5-tetramethylhexan-3-one;(E)-2,2,5,5-tetramethylhex-3-en-3-ol |
|---|---|
| PubChem CID | 158142695 |
| Molecular Formula | C21H44O2 |
| Molecular Weight | 328.58 g/mol |
| Exact Mass | 328.33 |
| IUPAC Name | methane;2,2,5,5-tetramethylhexan-3-one;(E)-2,2,5,5-tetramethylhex-3-en-3-ol |
| SMILES | C.CC(C)(C)/C=C(/O)C(C)(C)C.CC(C)(C)CC(=O)C(C)(C)C |
| InChI | InChI=1S/2C10H20O.CH4/c2*1-9(2,3)7-8(11)10(4,5)6;/h7H2,1-6H3;7,11H,1-6H3;1H4/b;8-7+; |
| InChIKey | FUDDRXOZLMZEGW-BVUSFOFSSA-N |
| XLogP | 7.19 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.58 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|