C8H12O4 — CID 58916017
2-(2,2-dimethylpropylidene)propanedioic acid (PubChem CID 58916017) has the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. Its IUPAC name is 2-(2,2-dimethylpropylidene)propanedioic acid.
| Compound Name | 2-(2,2-dimethylpropylidene)propanedioic acid |
|---|---|
| PubChem CID | 58916017 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 2-(2,2-dimethylpropylidene)propanedioic acid |
| SMILES | CC(C)(C)C=C(C(=O)O)C(=O)O |
| InChI | InChI=1S/C8H12O4/c1-8(2,3)4-5(6(9)10)7(11)12/h4H,1-3H3,(H,9,10)(H,11,12) |
| InChIKey | HCXIGDBAZYPBBL-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|