C9H14O4 — CID 5362877
(2E)-2-(2,2-dimethylpropylidene)butanedioic acid (PubChem CID 5362877) has the molecular formula C9H14O4 and a molecular weight of 186.21 g/mol. Its IUPAC name is (2E)-2-(2,2-dimethylpropylidene)butanedioic acid.
| Compound Name | (2E)-2-(2,2-dimethylpropylidene)butanedioic acid |
|---|---|
| PubChem CID | 5362877 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | (2E)-2-(2,2-dimethylpropylidene)butanedioic acid |
| SMILES | CC(C)(C)/C=C(\CC(=O)O)C(=O)O |
| InChI | InChI=1S/C9H14O4/c1-9(2,3)5-6(8(12)13)4-7(10)11/h5H,4H2,1-3H3,(H,10,11)(H,12,13)/b6-5+ |
| InChIKey | UTAVRWMVAXKFQV-AATRIKPKSA-N |
| XLogP | 1.52 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|