C36H62O4 — CID 70170187
2-[2,2,2-tri(cyclodecyl)ethylidene]butanedioic acid (PubChem CID 70170187) has the molecular formula C36H62O4 and a molecular weight of 558.89 g/mol. Its IUPAC name is 2-[2,2,2-tri(cyclodecyl)ethylidene]butanedioic acid.
| Compound Name | 2-[2,2,2-tri(cyclodecyl)ethylidene]butanedioic acid |
|---|---|
| PubChem CID | 70170187 |
| Molecular Formula | C36H62O4 |
| Molecular Weight | 558.89 g/mol |
| Exact Mass | 558.46 |
| IUPAC Name | 2-[2,2,2-tri(cyclodecyl)ethylidene]butanedioic acid |
| SMILES | O=C(O)CC(=CC(C1CCCCCCCCC1)(C1CCCCCCCCC1)C1CCCCCCCCC1)C(=O)O |
| InChI | InChI=1S/C36H62O4/c37-34(38)28-30(35(39)40)29-36(31-22-16-10-4-1-5-11-17-23-31,32-24-18-12-6-2-7-13-19-25-32)33-26-20-14-8-3-9-15-21-27-33/h29,31-33H,1-28H2,(H,37,38)(H,39,40) |
| InChIKey | AFPVNCXZXLKELM-UHFFFAOYSA-N |
| XLogP | 10.88 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.89 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|