(2E)-2-(acetamidomethylidene)butanedioic acid

C7H9NO5 — CID 6168433

IUPAC(2E)-2-(acetamidomethylidene)butanedioic acid
SMILESCC(=O)N/C=C(\CC(=O)O)C(=O)O
InChIInChI=1S/C7H9NO5/c1-4(9)8-3-5(7(12)13)2-6(10)11/h3H,2H2,1H3,(H,8,9)(H,10,11)(H,12,13)/b5-3+
InChIKeyCPBSBMPDIRRVGP-HWKANZROSA-N
MW187.15 g/mol
LogP-0.43
Rot. Bonds4

About (2E)-2-(acetamidomethylidene)butanedioic acid

(2E)-2-(acetamidomethylidene)butanedioic acid (PubChem CID 6168433) has the molecular formula C7H9NO5 and a molecular weight of 187.15 g/mol. Its IUPAC name is (2E)-2-(acetamidomethylidene)butanedioic acid.

Molecular Properties

Compound Name(2E)-2-(acetamidomethylidene)butanedioic acid
PubChem CID6168433
Molecular FormulaC7H9NO5
Molecular Weight187.15 g/mol
Exact Mass187.05
IUPAC Name(2E)-2-(acetamidomethylidene)butanedioic acid
SMILESCC(=O)N/C=C(\CC(=O)O)C(=O)O
InChIInChI=1S/C7H9NO5/c1-4(9)8-3-5(7(12)13)2-6(10)11/h3H,2H2,1H3,(H,8,9)(H,10,11)(H,12,13)/b5-3+
InChIKeyCPBSBMPDIRRVGP-HWKANZROSA-N
XLogP-0.43
TPSA103.70 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500187.15
LogP ≤ 5-0.43
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (2E)-2-(acetamidomethylidene)butanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-(acetamidomethylidene)-4-(diethylamino)butanoic acid
CID 123726003
N-[(Z)-2-hydroxyprop-1-enyl]acetamide
CID 154518387
(2Z)-2-(fluoromethylidene)butanedioic acid
CID 155605654
(2Z)-2-(2,2-dimethylpropylidene)butanedioic acid
CID 89292374
(2E)-2-(2,2-dimethylpropylidene)butanedioic acid
CID 5362877
(2E)-2-[(E)-but-2-enylidene]butanedioic acid
CID 87666227
2-ethylidenebutanedioic acid;prop-2-enoic acid
CID 162112732
but-2-ene-1,2,4-tricarboxylic acid
CID 57041970
(Z)-4-oxobut-2-ene-1,2,4-tricarboxylic acid
CID 5280779
(2Z)-2-[2-(hydroxyamino)-2-oxoethylidene]butanedioic acid
CID 163903254
ethenol;3-oxobutanoic acid
CID 87303365
2-octadecylidenebutanedioic acid
CID 141239026

Frequently Asked Questions

What is the IUPAC name of (2E)-2-(acetamidomethylidene)butanedioic acid?
The IUPAC name of (2E)-2-(acetamidomethylidene)butanedioic acid (CID 6168433) is (2E)-2-(acetamidomethylidene)butanedioic acid.
What is the SMILES notation for (2E)-2-(acetamidomethylidene)butanedioic acid?
The canonical SMILES for (2E)-2-(acetamidomethylidene)butanedioic acid is CC(=O)N/C=C(\CC(=O)O)C(=O)O.
What is the InChIKey of (2E)-2-(acetamidomethylidene)butanedioic acid?
The InChIKey is CPBSBMPDIRRVGP-HWKANZROSA-N. The full InChI is InChI=1S/C7H9NO5/c1-4(9)8-3-5(7(12)13)2-6(10)11/h3H,2H2,1H3,(H,8,9)(H,10,11)(H,12,13)/b5-3+.
What are the key properties of (2E)-2-(acetamidomethylidene)butanedioic acid?
(2E)-2-(acetamidomethylidene)butanedioic acid has a molecular weight of 187.15 g/mol, XLogP of -0.43, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-(acetamidomethylidene)butanedioic acid is sourced from PubChem (CID 6168433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).