C6H7NO6 — CID 163903254
(2Z)-2-[2-(hydroxyamino)-2-oxoethylidene]butanedioic acid (PubChem CID 163903254) has the molecular formula C6H7NO6 and a molecular weight of 189.12 g/mol. Its IUPAC name is (2Z)-2-[2-(hydroxyamino)-2-oxoethylidene]butanedioic acid.
| Compound Name | (2Z)-2-[2-(hydroxyamino)-2-oxoethylidene]butanedioic acid |
|---|---|
| PubChem CID | 163903254 |
| Molecular Formula | C6H7NO6 |
| Molecular Weight | 189.12 g/mol |
| Exact Mass | 189.03 |
| IUPAC Name | (2Z)-2-[2-(hydroxyamino)-2-oxoethylidene]butanedioic acid |
| SMILES | O=C(O)C/C(=C/C(=O)NO)C(=O)O |
| InChI | InChI=1S/C6H7NO6/c8-4(7-13)1-3(6(11)12)2-5(9)10/h1,13H,2H2,(H,7,8)(H,9,10)(H,11,12)/b3-1- |
| InChIKey | OORADLNDHGQASZ-IWQZZHSRSA-N |
| XLogP | -1.02 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.12 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|