C15H12O12 — CID 175105263
benzene-1,3,5-tricarboxylic acid;prop-1-ene-1,2,3-tricarboxylic acid (PubChem CID 175105263) has the molecular formula C15H12O12 and a molecular weight of 384.25 g/mol. Its IUPAC name is benzene-1,3,5-tricarboxylic acid;prop-1-ene-1,2,3-tricarboxylic acid.
| Compound Name | benzene-1,3,5-tricarboxylic acid;prop-1-ene-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 175105263 |
| Molecular Formula | C15H12O12 |
| Molecular Weight | 384.25 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | benzene-1,3,5-tricarboxylic acid;prop-1-ene-1,2,3-tricarboxylic acid |
| SMILES | O=C(O)C=C(CC(=O)O)C(=O)O.O=C(O)c1cc(C(=O)O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C9H6O6.C6H6O6/c10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15;7-4(8)1-3(6(11)12)2-5(9)10/h1-3H,(H,10,11)(H,12,13)(H,14,15);1H,2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | UHTLIPXKRXYABU-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 223.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.25 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|