C30H52O3 — CID 159894179
(Z,3E)-3-(2,2-dimethylpropylidene)-4,5,6,6-tetramethylhept-4-en-2-one;(Z,2E)-2-(2,2-dimethylpropylidene)-4,5,5-trimethylhex-3-enoic acid (PubChem CID 159894179) has the molecular formula C30H52O3 and a molecular weight of 460.74 g/mol. Its IUPAC name is (Z,3E)-3-(2,2-dimethylpropylidene)-4,5,6,6-tetramethylhept-4-en-2-one;(Z,2E)-2-(2,2-dimethylpropylidene)-4,5,5-trimethylhex-3-enoic acid.
| Compound Name | (Z,3E)-3-(2,2-dimethylpropylidene)-4,5,6,6-tetramethylhept-4-en-2-one;(Z,2E)-2-(2,2-dimethylpropylidene)-4,5,5-trimethylhex-3-enoic acid |
|---|---|
| PubChem CID | 159894179 |
| Molecular Formula | C30H52O3 |
| Molecular Weight | 460.74 g/mol |
| Exact Mass | 460.39 |
| IUPAC Name | (Z,3E)-3-(2,2-dimethylpropylidene)-4,5,6,6-tetramethylhept-4-en-2-one;(Z,2E)-2-(2,2-dimethylpropylidene)-4,5,5-trimethylhex-3-enoic acid |
| SMILES | C/C(=C/C(=C\C(C)(C)C)C(=O)O)C(C)(C)C.CC(=O)C(=C/C(C)(C)C)/C(C)=C(/C)C(C)(C)C |
| InChI | InChI=1S/C16H28O.C14H24O2/c1-11(12(2)16(7,8)9)14(13(3)17)10-15(4,5)6;1-10(14(5,6)7)8-11(12(15)16)9-13(2,3)4/h10H,1-9H3;8-9H,1-7H3,(H,15,16)/b12-11-,14-10+;10-8-,11-9+ |
| InChIKey | NVDFRYMJSVRTRW-GELNJNLDSA-N |
| XLogP | 8.97 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.74 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|