C47H82O3 — CID 158263341
bis((Z,3E)-3-(2,2-dimethylpropylidene)-4,5,6,6-tetramethylhept-4-en-2-one);(Z,3E)-3-(2,2-dimethylpropylidene)-5,6,6-trimethylhept-4-en-2-one (PubChem CID 158263341) has the molecular formula C47H82O3 and a molecular weight of 695.17 g/mol. Its IUPAC name is bis((Z,3E)-3-(2,2-dimethylpropylidene)-4,5,6,6-tetramethylhept-4-en-2-one);(Z,3E)-3-(2,2-dimethylpropylidene)-5,6,6-trimethylhept-4-en-2-one.
| Compound Name | bis((Z,3E)-3-(2,2-dimethylpropylidene)-4,5,6,6-tetramethylhept-4-en-2-one);(Z,3E)-3-(2,2-dimethylpropylidene)-5,6,6-trimethylhept-4-en-2-one |
|---|---|
| PubChem CID | 158263341 |
| Molecular Formula | C47H82O3 |
| Molecular Weight | 695.17 g/mol |
| Exact Mass | 694.63 |
| IUPAC Name | bis((Z,3E)-3-(2,2-dimethylpropylidene)-4,5,6,6-tetramethylhept-4-en-2-one);(Z,3E)-3-(2,2-dimethylpropylidene)-5,6,6-trimethylhept-4-en-2-one |
| SMILES | CC(=O)C(/C=C(/C)C(C)(C)C)=C/C(C)(C)C.CC(=O)C(=C/C(C)(C)C)/C(C)=C(/C)C(C)(C)C.CC(=O)C(=C/C(C)(C)C)/C(C)=C(/C)C(C)(C)C |
| InChI | InChI=1S/2C16H28O.C15H26O/c2*1-11(12(2)16(7,8)9)14(13(3)17)10-15(4,5)6;1-11(15(6,7)8)9-13(12(2)16)10-14(3,4)5/h2*10H,1-9H3;9-10H,1-8H3/b2*12-11-,14-10+;11-9-,13-10+ |
| InChIKey | GIDIMMKKYIGSQT-OAHOYVMBSA-N |
| XLogP | 14.40 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.17 |
| LogP ≤ 5 | 14.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|