C14H24BrN3O2 — CID 164920381
tert-butyl 4-[[(E)-3-amino-2-bromoprop-2-enylidene]amino]azepane-1-carboxylate (PubChem CID 164920381) has the molecular formula C14H24BrN3O2 and a molecular weight of 346.27 g/mol. Its IUPAC name is tert-butyl 4-[[(E)-3-amino-2-bromoprop-2-enylidene]amino]azepane-1-carboxylate.
| Compound Name | tert-butyl 4-[[(E)-3-amino-2-bromoprop-2-enylidene]amino]azepane-1-carboxylate |
|---|---|
| PubChem CID | 164920381 |
| Molecular Formula | C14H24BrN3O2 |
| Molecular Weight | 346.27 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | tert-butyl 4-[[(E)-3-amino-2-bromoprop-2-enylidene]amino]azepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(/N=C/C(Br)=C\N)CC1 |
| InChI | InChI=1S/C14H24BrN3O2/c1-14(2,3)20-13(19)18-7-4-5-12(6-8-18)17-10-11(15)9-16/h9-10,12H,4-8,16H2,1-3H3/b11-9+,17-10+ |
| InChIKey | KFVBFHFJJAWTBT-ATELFFGISA-N |
| XLogP | 3.04 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.27 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|